C15H21NOS — CID 51968728
trans-(1R,2R)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 51968728) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is trans-(1R,2R)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51968728 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | trans-(1R,2R)-N-[2-(3,4-dimethylphenyl)sulfanylethyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)[C@@H]2C[C@H]2C)cc1C |
| InChI | InChI=1S/C15H21NOS/c1-10-4-5-13(8-11(10)2)18-7-6-16-15(17)14-9-12(14)3/h4-5,8,12,14H,6-7,9H2,1-3H3,(H,16,17)/t12-,14-/m1/s1 |
| InChIKey | FNPUYNPASAWGHY-TZMCWYRMSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|