C21H25N3O5S — CID 51969648
N-[(E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 51969648) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 51969648 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[(E)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethylideneamino]-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | C/C(=N\NC(=O)CN(C)S(=O)(=O)c1ccc(C)cc1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H25N3O5S/c1-15-5-8-18(9-6-15)30(26,27)24(3)14-21(25)23-22-16(2)17-7-10-19-20(13-17)29-12-4-11-28-19/h5-10,13H,4,11-12,14H2,1-3H3,(H,23,25)/b22-16+ |
| InChIKey | FTWWNIRLSJMTDW-CJLVFECKSA-N |
| XLogP | 2.32 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|