About 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one
6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one (PubChem CID 51970546) has the molecular formula C8H9ClN2O3S
and a molecular weight of 248.69 g/mol. Its IUPAC name is 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one.
Molecular Properties
| Compound Name | 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one |
| PubChem CID | 51970546 |
| Molecular Formula | C8H9ClN2O3S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one |
| SMILES | O=c1ccc(Cl)nn1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H9ClN2O3S/c9-7-1-2-8(12)11(10-7)6-3-4-15(13,14)5-6/h1-2,6H,3-5H2/t6-/m1/s1 |
| InChIKey | WHPXIXQVTVULOB-ZCFIWIBFSA-N |
| XLogP | 0.26 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one?
The IUPAC name of 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one (CID 51970546) is 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one.
What is the SMILES notation for 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one?
The canonical SMILES for 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one is O=c1ccc(Cl)nn1[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one?
The InChIKey is WHPXIXQVTVULOB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H9ClN2O3S/c9-7-1-2-8(12)11(10-7)6-3-4-15(13,14)5-6/h1-2,6H,3-5H2/t6-/m1/s1.
What are the key properties of 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one?
6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one has a molecular weight of 248.69 g/mol, XLogP of 0.26, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[(3R)-1,1-dioxothiolan-3-yl]pyridazin-3-one is sourced from PubChem (CID 51970546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).