About ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate
ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate (PubChem CID 5197333) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate |
| PubChem CID | 5197333 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate |
| SMILES | CCOC(=O)NNC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C11H18N2O3/c1-4-16-10(15)13-12-8-5-9(14)7-11(2,3)6-8/h5,12H,4,6-7H2,1-3H3,(H,13,15) |
| InChIKey | GMOMCVQHDUVJLG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate?
The IUPAC name of ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate (CID 5197333) is ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate.
What is the SMILES notation for ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate?
The canonical SMILES for ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate is CCOC(=O)NNC1=CC(=O)CC(C)(C)C1.
What is the InChIKey of ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate?
The InChIKey is GMOMCVQHDUVJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-4-16-10(15)13-12-8-5-9(14)7-11(2,3)6-8/h5,12H,4,6-7H2,1-3H3,(H,13,15).
What are the key properties of ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate?
ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate has a molecular weight of 226.28 g/mol, XLogP of 1.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamate is sourced from PubChem (CID 5197333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).