C21H17F3N2O5 — CID 51973629
(5S)-3-(2,3-dimethoxyphenyl)-7-[3-(trifluoromethyl)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione (PubChem CID 51973629) has the molecular formula C21H17F3N2O5 and a molecular weight of 434.37 g/mol. Its IUPAC name is (5S)-3-(2,3-dimethoxyphenyl)-7-[3-(trifluoromethyl)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione.
| Compound Name | (5S)-3-(2,3-dimethoxyphenyl)-7-[3-(trifluoromethyl)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
|---|---|
| PubChem CID | 51973629 |
| Molecular Formula | C21H17F3N2O5 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (5S)-3-(2,3-dimethoxyphenyl)-7-[3-(trifluoromethyl)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-6,8-dione |
| SMILES | COc1cccc(C2=NO[C@]3(CC(=O)N(c4cccc(C(F)(F)F)c4)C3=O)C2)c1OC |
| InChI | InChI=1S/C21H17F3N2O5/c1-29-16-8-4-7-14(18(16)30-2)15-10-20(31-25-15)11-17(27)26(19(20)28)13-6-3-5-12(9-13)21(22,23)24/h3-9H,10-11H2,1-2H3/t20-/m0/s1 |
| InChIKey | JLHCUPHDAHLBAQ-FQEVSTJZSA-N |
| XLogP | 3.55 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|