C21H21FN4O4 — CID 51974359
(2S)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetic acid (PubChem CID 51974359) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is (2S)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetic acid.
| Compound Name | (2S)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 51974359 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (2S)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetic acid |
| SMILES | O=C(O)Cn1cc([C@@H](C(=O)O)N2CCN(c3ccccn3)CC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C21H21FN4O4/c22-14-4-5-15-16(12-26(13-19(27)28)17(15)11-14)20(21(29)30)25-9-7-24(8-10-25)18-3-1-2-6-23-18/h1-6,11-12,20H,7-10,13H2,(H,27,28)(H,29,30)/t20-/m0/s1 |
| InChIKey | QBTWDKPVQBBLQL-FQEVSTJZSA-N |
| XLogP | 2.21 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |