C24H25FN2O4 — CID 51720443
(2S)-2-(4-benzylpiperidin-1-yl)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]acetic acid (PubChem CID 51720443) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is (2S)-2-(4-benzylpiperidin-1-yl)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]acetic acid.
| Compound Name | (2S)-2-(4-benzylpiperidin-1-yl)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 51720443 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2S)-2-(4-benzylpiperidin-1-yl)-2-[1-(carboxymethyl)-6-fluoroindol-3-yl]acetic acid |
| SMILES | O=C(O)Cn1cc([C@@H](C(=O)O)N2CCC(Cc3ccccc3)CC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C24H25FN2O4/c25-18-6-7-19-20(14-27(15-22(28)29)21(19)13-18)23(24(30)31)26-10-8-17(9-11-26)12-16-4-2-1-3-5-16/h1-7,13-14,17,23H,8-12,15H2,(H,28,29)(H,30,31)/t23-/m0/s1 |
| InChIKey | BFFGBOWMKVWSGO-QHCPKHFHSA-N |
| XLogP | 3.95 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |