C25H27FN2O4 — CID 45492032
3-[3-[(4-benzylpiperidin-1-yl)-carboxymethyl]-6-fluoroindol-1-yl]propanoic acid (PubChem CID 45492032) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 3-[3-[(4-benzylpiperidin-1-yl)-carboxymethyl]-6-fluoroindol-1-yl]propanoic acid.
| Compound Name | 3-[3-[(4-benzylpiperidin-1-yl)-carboxymethyl]-6-fluoroindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 45492032 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[3-[(4-benzylpiperidin-1-yl)-carboxymethyl]-6-fluoroindol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(C(C(=O)O)N2CCC(Cc3ccccc3)CC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C25H27FN2O4/c26-19-6-7-20-21(16-28(22(20)15-19)13-10-23(29)30)24(25(31)32)27-11-8-18(9-12-27)14-17-4-2-1-3-5-17/h1-7,15-16,18,24H,8-14H2,(H,29,30)(H,31,32) |
| InChIKey | DPUJEHUPPWVFGF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |