C15H29NO — CID 51980420
[(3S)-1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-3-yl]methanol (PubChem CID 51980420) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is [(3S)-1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 51980420 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | [(3S)-1-[(2S)-2,6-dimethylhept-5-enyl]piperidin-3-yl]methanol |
| SMILES | CC(C)=CCC[C@H](C)CN1CCC[C@H](CO)C1 |
| InChI | InChI=1S/C15H29NO/c1-13(2)6-4-7-14(3)10-16-9-5-8-15(11-16)12-17/h6,14-15,17H,4-5,7-12H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | FWFISHFNIWPLMS-GJZGRUSLSA-N |
| XLogP | 3.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|