C21H38N2O — CID 45249688
3-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 45249688) has the molecular formula C21H38N2O and a molecular weight of 334.55 g/mol. Its IUPAC name is 3-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 45249688 |
| Molecular Formula | C21H38N2O |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.30 |
| IUPAC Name | 3-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(C)=CCCC(C)CN1CCC(CCC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C21H38N2O/c1-18(2)7-6-8-19(3)17-22-15-11-20(12-16-22)9-10-21(24)23-13-4-5-14-23/h7,19-20H,4-6,8-17H2,1-3H3 |
| InChIKey | KQVJFCWZXVQXBW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|