C27H47NO — CID 70403089
1-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one (PubChem CID 70403089) has the molecular formula C27H47NO and a molecular weight of 401.68 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one |
|---|---|
| PubChem CID | 70403089 |
| Molecular Formula | C27H47NO |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.37 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-3,7,11,15-tetramethylhexadeca-6,10,14-trien-1-one |
| SMILES | CCN1CCCC(C(=O)CC(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C1 |
| InChI | InChI=1S/C27H47NO/c1-7-28-19-11-18-26(21-28)27(29)20-25(6)17-10-16-24(5)15-9-14-23(4)13-8-12-22(2)3/h12,14,16,25-26H,7-11,13,15,17-21H2,1-6H3 |
| InChIKey | NDIPWXPBDZDEFK-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|