C19H20N2O3S — CID 51982491
methyl (3S,4R)-5-cyano-4-(4-methylphenyl)-6-(2-methylprop-2-enylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 51982491) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is methyl (3S,4R)-5-cyano-4-(4-methylphenyl)-6-(2-methylprop-2-enylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl (3S,4R)-5-cyano-4-(4-methylphenyl)-6-(2-methylprop-2-enylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 51982491 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | methyl (3S,4R)-5-cyano-4-(4-methylphenyl)-6-(2-methylprop-2-enylsulfanyl)-2-oxo-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | C=C(C)CSC1=C(C#N)[C@@H](c2ccc(C)cc2)[C@H](C(=O)OC)C(=O)N1 |
| InChI | InChI=1S/C19H20N2O3S/c1-11(2)10-25-18-14(9-20)15(13-7-5-12(3)6-8-13)16(17(22)21-18)19(23)24-4/h5-8,15-16H,1,10H2,2-4H3,(H,21,22)/t15-,16+/m1/s1 |
| InChIKey | IKPFYZROWPMKKJ-CVEARBPZSA-N |
| XLogP | 3.04 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|