C14H23ClN6O — CID 51983147
2-[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]-N-[(2R)-butan-2-yl]acetamide (PubChem CID 51983147) has the molecular formula C14H23ClN6O and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]-N-[(2R)-butan-2-yl]acetamide.
| Compound Name | 2-[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]-N-[(2R)-butan-2-yl]acetamide |
|---|---|
| PubChem CID | 51983147 |
| Molecular Formula | C14H23ClN6O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-[4-(2-amino-6-chloropyrimidin-4-yl)piperazin-1-yl]-N-[(2R)-butan-2-yl]acetamide |
| SMILES | CC[C@@H](C)NC(=O)CN1CCN(c2cc(Cl)nc(N)n2)CC1 |
| InChI | InChI=1S/C14H23ClN6O/c1-3-10(2)17-13(22)9-20-4-6-21(7-5-20)12-8-11(15)18-14(16)19-12/h8,10H,3-7,9H2,1-2H3,(H,17,22)(H2,16,18,19)/t10-/m1/s1 |
| InChIKey | FWTQQZNSRWKVIW-SNVBAGLBSA-N |
| XLogP | 0.75 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |