C15H17ClN4OS — CID 51983817
(3S)-1-(6-chloropyridazin-3-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 51983817) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is (3S)-1-(6-chloropyridazin-3-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(6-chloropyridazin-3-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51983817 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (3S)-1-(6-chloropyridazin-3-yl)-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)[C@H]1CCCN(c2ccc(Cl)nn2)C1 |
| InChI | InChI=1S/C15H17ClN4OS/c16-13-5-6-14(19-18-13)20-7-1-3-11(10-20)15(21)17-9-12-4-2-8-22-12/h2,4-6,8,11H,1,3,7,9-10H2,(H,17,21)/t11-/m0/s1 |
| InChIKey | QQMNGTVQROQPTJ-NSHDSACASA-N |
| XLogP | 2.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |