C18H21N3O2 — CID 51984750
(E)-1-[(2R)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 51984750) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (E)-1-[(2R)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(2R)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 51984750 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (E)-1-[(2R)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | CCc1noc([C@H]2CCCCN2C(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N3O2/c1-2-16-19-18(23-20-16)15-10-6-7-13-21(15)17(22)12-11-14-8-4-3-5-9-14/h3-5,8-9,11-12,15H,2,6-7,10,13H2,1H3/b12-11+/t15-/m1/s1 |
| InChIKey | OBPRWDHQEBAKGS-AYJWMTRPSA-N |
| XLogP | 3.40 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|