C18H26N2O2S — CID 51984825
(3R)-1-ethyl-3-[[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]piperidin-3-ol (PubChem CID 51984825) has the molecular formula C18H26N2O2S and a molecular weight of 334.48 g/mol. Its IUPAC name is (3R)-1-ethyl-3-[[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]piperidin-3-ol.
| Compound Name | (3R)-1-ethyl-3-[[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 51984825 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (3R)-1-ethyl-3-[[furan-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]piperidin-3-ol |
| SMILES | CCN1CCC[C@](O)(CN(Cc2ccco2)Cc2cccs2)C1 |
| InChI | InChI=1S/C18H26N2O2S/c1-2-19-9-5-8-18(21,14-19)15-20(12-16-6-3-10-22-16)13-17-7-4-11-23-17/h3-4,6-7,10-11,21H,2,5,8-9,12-15H2,1H3/t18-/m1/s1 |
| InChIKey | IIDAWUUMUFXJQS-GOSISDBHSA-N |
| XLogP | 3.19 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |