C22H21ClFNO2 — CID 51989098
(1S)-2-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]-1-phenylethanol (PubChem CID 51989098) has the molecular formula C22H21ClFNO2 and a molecular weight of 385.87 g/mol. Its IUPAC name is (1S)-2-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]-1-phenylethanol.
| Compound Name | (1S)-2-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 51989098 |
| Molecular Formula | C22H21ClFNO2 |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (1S)-2-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]methylamino]-1-phenylethanol |
| SMILES | O[C@H](CNCc1ccc(OCc2ccc(F)cc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H21ClFNO2/c23-21-12-19(24)9-8-18(21)15-27-20-10-6-16(7-11-20)13-25-14-22(26)17-4-2-1-3-5-17/h1-12,22,25-26H,13-15H2/t22-/m1/s1 |
| InChIKey | YYRFMRHOPXRASV-JOCHJYFZSA-N |
| XLogP | 4.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |