C21H28N2O6S — CID 5199582
ethyl 2-[3-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 5199582) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is ethyl 2-[3-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl 2-[3-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 5199582 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | ethyl 2-[3-[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)C=C1SCC(=O)N1CC(=O)NCCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C21H28N2O6S/c1-4-27-16-8-7-15(11-17(16)28-5-2)9-10-22-18(24)13-23-19(25)14-30-20(23)12-21(26)29-6-3/h7-8,11-12H,4-6,9-10,13-14H2,1-3H3,(H,22,24) |
| InChIKey | FQYYSTGHGYUHTC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|