C17H15FN4O3 — CID 51999079
N-[(2-fluorophenyl)methyl]-5-(furan-2-carbonylamino)-1-methylpyrazole-3-carboxamide (PubChem CID 51999079) has the molecular formula C17H15FN4O3 and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-(furan-2-carbonylamino)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-5-(furan-2-carbonylamino)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51999079 |
| Molecular Formula | C17H15FN4O3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-(furan-2-carbonylamino)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2ccccc2F)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C17H15FN4O3/c1-22-15(20-17(24)14-7-4-8-25-14)9-13(21-22)16(23)19-10-11-5-2-3-6-12(11)18/h2-9H,10H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | LANJULGAEQGZRP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |