C15H13ClN4O4 — CID 5201297
1-(3-chlorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]urea (PubChem CID 5201297) has the molecular formula C15H13ClN4O4 and a molecular weight of 348.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]urea |
|---|---|
| PubChem CID | 5201297 |
| Molecular Formula | C15H13ClN4O4 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(3-methyl-4-nitrobenzoyl)amino]urea |
| SMILES | Cc1cc(C(=O)NNC(=O)Nc2cccc(Cl)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13ClN4O4/c1-9-7-10(5-6-13(9)20(23)24)14(21)18-19-15(22)17-12-4-2-3-11(16)8-12/h2-8H,1H3,(H,18,21)(H2,17,19,22) |
| InChIKey | UXKFJGGJQRAEBF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|