About methyl 16-methyloctadecanoate
methyl 16-methyloctadecanoate (PubChem CID 520158) has the molecular formula C20H40O2
and a molecular weight of 312.54 g/mol. Its IUPAC name is methyl 16-methyloctadecanoate.
Molecular Properties
| Compound Name | methyl 16-methyloctadecanoate |
| PubChem CID | 520158 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | methyl 16-methyloctadecanoate |
| SMILES | CCC(C)CCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C20H40O2/c1-4-19(2)17-15-13-11-9-7-5-6-8-10-12-14-16-18-20(21)22-3/h19H,4-18H2,1-3H3 |
| InChIKey | IAAPBHVWQFGAED-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 16-methyloctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 16-methyloctadecanoate?
The IUPAC name of methyl 16-methyloctadecanoate (CID 520158) is methyl 16-methyloctadecanoate.
What is the SMILES notation for methyl 16-methyloctadecanoate?
The canonical SMILES for methyl 16-methyloctadecanoate is CCC(C)CCCCCCCCCCCCCCC(=O)OC.
What is the InChIKey of methyl 16-methyloctadecanoate?
The InChIKey is IAAPBHVWQFGAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O2/c1-4-19(2)17-15-13-11-9-7-5-6-8-10-12-14-16-18-20(21)22-3/h19H,4-18H2,1-3H3.
What are the key properties of methyl 16-methyloctadecanoate?
methyl 16-methyloctadecanoate has a molecular weight of 312.54 g/mol, XLogP of 6.67, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 16-methyloctadecanoate is sourced from PubChem (CID 520158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).