C27H24FN3O3 — CID 5201781
2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-ethoxyphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 5201781) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-ethoxyphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-ethoxyphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 5201781 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-perimidin-2-yl)-2-ethoxyphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(C2Nc3cccc4cccc(c34)N2)ccc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H24FN3O3/c1-2-33-24-15-18(27-30-21-7-3-5-17-6-4-8-22(31-27)26(17)21)9-14-23(24)34-16-25(32)29-20-12-10-19(28)11-13-20/h3-15,27,30-31H,2,16H2,1H3,(H,29,32) |
| InChIKey | XEBBJHZAHKGXLI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|