C30H27BCl2N2O7 — CID 5202016
[3-[6a,9a-dichloro-6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 5202016) has the molecular formula C30H27BCl2N2O7 and a molecular weight of 609.27 g/mol. Its IUPAC name is [3-[6a,9a-dichloro-6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6a,9a-dichloro-6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 5202016 |
| Molecular Formula | C30H27BCl2N2O7 |
| Molecular Weight | 609.27 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | [3-[6a,9a-dichloro-6-(2-hydroxy-3-prop-2-enylphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | C=CCc1cccc(C2C3=CCC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C30H27BCl2N2O7/c1-3-6-15-7-4-10-20(24(15)36)23-18-11-12-19-22(21(18)14-29(32)27(39)34(2)28(40)30(23,29)33)26(38)35(25(19)37)17-9-5-8-16(13-17)31(41)42/h3-5,7-11,13,19,21-23,36,41-42H,1,6,12,14H2,2H3 |
| InChIKey | YWKDVBAATTURJI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|