C28H23N3O2 — CID 5203368
10-(4-ethoxyphenyl)-12-methyl-14-phenyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaen-8-one (PubChem CID 5203368) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 10-(4-ethoxyphenyl)-12-methyl-14-phenyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaen-8-one.
| Compound Name | 10-(4-ethoxyphenyl)-12-methyl-14-phenyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaen-8-one |
|---|---|
| PubChem CID | 5203368 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 10-(4-ethoxyphenyl)-12-methyl-14-phenyl-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,11(15),12-hexaen-8-one |
| SMILES | CCOc1ccc(C2C3=C(Nc4c2c(C)nn4-c2ccccc2)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C28H23N3O2/c1-3-33-20-15-13-18(14-16-20)24-23-17(2)30-31(19-9-5-4-6-10-19)28(23)29-26-21-11-7-8-12-22(21)27(32)25(24)26/h4-16,24,29H,3H2,1-2H3 |
| InChIKey | CHYJIYMGIHNWJS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |