C23H23FN4O2 — CID 5204065
N-[3-(benzylamino)-3-oxopropyl]-N-[(4-fluorophenyl)methyl]-5-methylpyrazine-2-carboxamide (PubChem CID 5204065) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[3-(benzylamino)-3-oxopropyl]-N-[(4-fluorophenyl)methyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[3-(benzylamino)-3-oxopropyl]-N-[(4-fluorophenyl)methyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 5204065 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[3-(benzylamino)-3-oxopropyl]-N-[(4-fluorophenyl)methyl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)N(CCC(=O)NCc2ccccc2)Cc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C23H23FN4O2/c1-17-13-26-21(15-25-17)23(30)28(16-19-7-9-20(24)10-8-19)12-11-22(29)27-14-18-5-3-2-4-6-18/h2-10,13,15H,11-12,14,16H2,1H3,(H,27,29) |
| InChIKey | RYQJULWFUJJCSG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |