C27H26N4O2 — CID 5205012
3-(2,2-diphenylethyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine (PubChem CID 5205012) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-(2,2-diphenylethyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine.
| Compound Name | 3-(2,2-diphenylethyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine |
|---|---|
| PubChem CID | 5205012 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-(2,2-diphenylethyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-b]azepine |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(CC(c3ccccc3)c3ccccc3)c3c2NCCCC3)cc1 |
| InChI | InChI=1S/C27H26N4O2/c32-31(33)23-16-14-22(15-17-23)30-27-24(13-7-8-18-28-27)26(29-30)19-25(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-6,9-12,14-17,25,28H,7-8,13,18-19H2 |
| InChIKey | RWVHZYUCXOKGPJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|