C19H16Cl2N4O2 — CID 3932707
3-(2,6-dichlorophenyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine (PubChem CID 3932707) has the molecular formula C19H16Cl2N4O2 and a molecular weight of 403.27 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine.
| Compound Name | 3-(2,6-dichlorophenyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 3932707 |
| Molecular Formula | C19H16Cl2N4O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1-(4-nitrophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3c(Cl)cccc3Cl)c3c2NCCCC3)cc1 |
| InChI | InChI=1S/C19H16Cl2N4O2/c20-15-5-3-6-16(21)17(15)18-14-4-1-2-11-22-19(14)24(23-18)12-7-9-13(10-8-12)25(26)27/h3,5-10,22H,1-2,4,11H2 |
| InChIKey | NPFKBMQJYBWGAQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|