C17H12ClFN4O2 — CID 3933270
3-(2-chloro-4-fluorophenyl)-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 3933270) has the molecular formula C17H12ClFN4O2 and a molecular weight of 358.76 g/mol. Its IUPAC name is 3-(2-chloro-4-fluorophenyl)-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
| Compound Name | 3-(2-chloro-4-fluorophenyl)-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
|---|---|
| PubChem CID | 3933270 |
| Molecular Formula | C17H12ClFN4O2 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-(2-chloro-4-fluorophenyl)-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3ccc(F)cc3Cl)c3c2NCC3)cc1 |
| InChI | InChI=1S/C17H12ClFN4O2/c18-15-9-10(19)1-6-13(15)16-14-7-8-20-17(14)22(21-16)11-2-4-12(5-3-11)23(24)25/h1-6,9,20H,7-8H2 |
| InChIKey | PKZFTBCLLBNVFT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|