C18H12ClF3N4O2 — CID 4541174
3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 4541174) has the molecular formula C18H12ClF3N4O2 and a molecular weight of 408.77 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
|---|---|
| PubChem CID | 4541174 |
| Molecular Formula | C18H12ClF3N4O2 |
| Molecular Weight | 408.77 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(4-nitrophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3cc(C(F)(F)F)ccc3Cl)c3c2NCC3)cc1 |
| InChI | InChI=1S/C18H12ClF3N4O2/c19-15-6-1-10(18(20,21)22)9-14(15)16-13-7-8-23-17(13)25(24-16)11-2-4-12(5-3-11)26(27)28/h1-6,9,23H,7-8H2 |
| InChIKey | GJDANSHCODCSPW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|