C26H25N5O3S — CID 5205693
N-[1-[4-(4-methylphenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-3-nitrobenzamide (PubChem CID 5205693) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is N-[1-[4-(4-methylphenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-[1-[4-(4-methylphenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 5205693 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-[1-[4-(4-methylphenyl)-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazol-3-yl]ethyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(-n2c(SCc3ccccc3C)nnc2C(C)NC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H25N5O3S/c1-17-11-13-22(14-12-17)30-24(28-29-26(30)35-16-21-8-5-4-7-18(21)2)19(3)27-25(32)20-9-6-10-23(15-20)31(33)34/h4-15,19H,16H2,1-3H3,(H,27,32) |
| InChIKey | OGAPXYZZDVUMCB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|