C28H35Cl2N2O7PS2 — CID 5208098
4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-dipentoxyphosphorylphenyl]benzenesulfonamide (PubChem CID 5208098) has the molecular formula C28H35Cl2N2O7PS2 and a molecular weight of 677.61 g/mol. Its IUPAC name is 4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-dipentoxyphosphorylphenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-dipentoxyphosphorylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 5208098 |
| Molecular Formula | C28H35Cl2N2O7PS2 |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 676.10 |
| IUPAC Name | 4-chloro-N-[4-[(4-chlorophenyl)sulfonylamino]-3-dipentoxyphosphorylphenyl]benzenesulfonamide |
| SMILES | CCCCCOP(=O)(OCCCCC)c1cc(NS(=O)(=O)c2ccc(Cl)cc2)ccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H35Cl2N2O7PS2/c1-3-5-7-19-38-40(33,39-20-8-6-4-2)28-21-24(31-41(34,35)25-14-9-22(29)10-15-25)13-18-27(28)32-42(36,37)26-16-11-23(30)12-17-26/h9-18,21,31-32H,3-8,19-20H2,1-2H3 |
| InChIKey | BLPUVCATQYDTSC-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|