About 7-phenylheptanoic acid
7-phenylheptanoic acid (PubChem CID 520987) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 7-phenylheptanoic acid.
Molecular Properties
| Compound Name | 7-phenylheptanoic acid |
| PubChem CID | 520987 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 7-phenylheptanoic acid |
| SMILES | O=C(O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
| InChIKey | ZVSXKFNTWOIGJI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-phenylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylheptanoic acid?
The IUPAC name of 7-phenylheptanoic acid (CID 520987) is 7-phenylheptanoic acid.
What is the SMILES notation for 7-phenylheptanoic acid?
The canonical SMILES for 7-phenylheptanoic acid is O=C(O)CCCCCCc1ccccc1.
What is the InChIKey of 7-phenylheptanoic acid?
The InChIKey is ZVSXKFNTWOIGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15).
What are the key properties of 7-phenylheptanoic acid?
7-phenylheptanoic acid has a molecular weight of 206.29 g/mol, XLogP of 3.26, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylheptanoic acid is sourced from PubChem (CID 520987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).