7-phenylheptanoic acid

C13H18O2 — CID 520987

IUPAC7-phenylheptanoic acid
SMILESO=C(O)CCCCCCc1ccccc1
InChIInChI=1S/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15)
InChIKeyZVSXKFNTWOIGJI-UHFFFAOYSA-N
MW206.29 g/mol
LogP3.26
Rot. Bonds7

About 7-phenylheptanoic acid

7-phenylheptanoic acid (PubChem CID 520987) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 7-phenylheptanoic acid.

Molecular Properties

Compound Name7-phenylheptanoic acid
PubChem CID520987
Molecular FormulaC13H18O2
Molecular Weight206.29 g/mol
Exact Mass206.13
IUPAC Name7-phenylheptanoic acid
SMILESO=C(O)CCCCCCc1ccccc1
InChIInChI=1S/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15)
InChIKeyZVSXKFNTWOIGJI-UHFFFAOYSA-N
XLogP3.26
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.29
LogP ≤ 53.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 7-phenylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-phenylheptanoic acid?
The IUPAC name of 7-phenylheptanoic acid (CID 520987) is 7-phenylheptanoic acid.
What is the SMILES notation for 7-phenylheptanoic acid?
The canonical SMILES for 7-phenylheptanoic acid is O=C(O)CCCCCCc1ccccc1.
What is the InChIKey of 7-phenylheptanoic acid?
The InChIKey is ZVSXKFNTWOIGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15).
What are the key properties of 7-phenylheptanoic acid?
7-phenylheptanoic acid has a molecular weight of 206.29 g/mol, XLogP of 3.26, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylheptanoic acid is sourced from PubChem (CID 520987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).