C24H18BrN3O2S — CID 5213202
2-(3-bromophenyl)-N-[(4-hydroxyphenyl)-methylcarbamothioyl]quinoline-4-carboxamide (PubChem CID 5213202) has the molecular formula C24H18BrN3O2S and a molecular weight of 492.40 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[(4-hydroxyphenyl)-methylcarbamothioyl]quinoline-4-carboxamide.
| Compound Name | 2-(3-bromophenyl)-N-[(4-hydroxyphenyl)-methylcarbamothioyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5213202 |
| Molecular Formula | C24H18BrN3O2S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | 2-(3-bromophenyl)-N-[(4-hydroxyphenyl)-methylcarbamothioyl]quinoline-4-carboxamide |
| SMILES | CN(C(=S)NC(=O)c1cc(-c2cccc(Br)c2)nc2ccccc12)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H18BrN3O2S/c1-28(17-9-11-18(29)12-10-17)24(31)27-23(30)20-14-22(15-5-4-6-16(25)13-15)26-21-8-3-2-7-19(20)21/h2-14,29H,1H3,(H,27,30,31) |
| InChIKey | FZESLOSPFCXCMV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|