C17H24N2O — CID 5213309
2-(3,3-dimethyl-4H-isoquinolin-1-yl)-4-methylpentanamide (PubChem CID 5213309) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-4-methylpentanamide.
| Compound Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 5213309 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(N)=O)C1=NC(C)(C)Cc2ccccc21 |
| InChI | InChI=1S/C17H24N2O/c1-11(2)9-14(16(18)20)15-13-8-6-5-7-12(13)10-17(3,4)19-15/h5-8,11,14H,9-10H2,1-4H3,(H2,18,20) |
| InChIKey | SIQDYWFHJMGTJM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |