C31H25N5O3 — CID 5214400
3-(furan-2-yl)-N-[5-methyl-2-[1-[(3-phenoxyphenyl)methyl]benzimidazol-2-yl]pyrazol-3-yl]prop-2-enamide (PubChem CID 5214400) has the molecular formula C31H25N5O3 and a molecular weight of 515.57 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[5-methyl-2-[1-[(3-phenoxyphenyl)methyl]benzimidazol-2-yl]pyrazol-3-yl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[5-methyl-2-[1-[(3-phenoxyphenyl)methyl]benzimidazol-2-yl]pyrazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5214400 |
| Molecular Formula | C31H25N5O3 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 3-(furan-2-yl)-N-[5-methyl-2-[1-[(3-phenoxyphenyl)methyl]benzimidazol-2-yl]pyrazol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(NC(=O)C=Cc2ccco2)n(-c2nc3ccccc3n2Cc2cccc(Oc3ccccc3)c2)n1 |
| InChI | InChI=1S/C31H25N5O3/c1-22-19-29(33-30(37)17-16-24-13-8-18-38-24)36(34-22)31-32-27-14-5-6-15-28(27)35(31)21-23-9-7-12-26(20-23)39-25-10-3-2-4-11-25/h2-20H,21H2,1H3,(H,33,37) |
| InChIKey | ZOKGGAQHRKZRHI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|