C23H19Cl2N3O2 — CID 40785211
(E)-N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 40785211) has the molecular formula C23H19Cl2N3O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 40785211 |
| Molecular Formula | C23H19Cl2N3O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (E)-N-[(1S)-1-[1-[(2,6-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccco1)c1nc2ccccc2n1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H19Cl2N3O2/c1-15(26-22(29)12-11-16-6-5-13-30-16)23-27-20-9-2-3-10-21(20)28(23)14-17-18(24)7-4-8-19(17)25/h2-13,15H,14H2,1H3,(H,26,29)/b12-11+/t15-/m0/s1 |
| InChIKey | LAOSXDFJKGEUSY-RUMSDORHSA-N |
| XLogP | 5.88 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|