C18H26ClNOS — CID 5215656
3-[(4-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylcyclohexyl)propanamide (PubChem CID 5215656) has the molecular formula C18H26ClNOS and a molecular weight of 339.93 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylcyclohexyl)propanamide.
| Compound Name | 3-[(4-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 5215656 |
| Molecular Formula | C18H26ClNOS |
| Molecular Weight | 339.93 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfanyl]-N-(2,3-dimethylcyclohexyl)propanamide |
| SMILES | CC1CCCC(NC(=O)CCSCc2ccc(Cl)cc2)C1C |
| InChI | InChI=1S/C18H26ClNOS/c1-13-4-3-5-17(14(13)2)20-18(21)10-11-22-12-15-6-8-16(19)9-7-15/h6-9,13-14,17H,3-5,10-12H2,1-2H3,(H,20,21) |
| InChIKey | REVIGAMHFTYXHP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.93 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|