C32H30N4O6S2 — CID 5216824
3-methylidene-1-N,2-N-bis[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 5216824) has the molecular formula C32H30N4O6S2 and a molecular weight of 630.75 g/mol. Its IUPAC name is 3-methylidene-1-N,2-N-bis[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 3-methylidene-1-N,2-N-bis[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 5216824 |
| Molecular Formula | C32H30N4O6S2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | 3-methylidene-1-N,2-N-bis[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | C=C1C(C(=O)Nc2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2)C1C(=O)Nc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H30N4O6S2/c1-20-4-16-27(17-5-20)43(39,40)35-25-12-8-23(9-13-25)33-31(37)29-22(3)30(29)32(38)34-24-10-14-26(15-11-24)36-44(41,42)28-18-6-21(2)7-19-28/h4-19,29-30,35-36H,3H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | CTQDSJRNXOQIJW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|