C20H13F11N2O3S — CID 19685211
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclohexane-1-carboxamide (PubChem CID 19685211) has the molecular formula C20H13F11N2O3S and a molecular weight of 570.38 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 19685211 |
| Molecular Formula | C20H13F11N2O3S |
| Molecular Weight | 570.38 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NC(=O)C3(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C3(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H13F11N2O3S/c1-10-2-8-13(9-3-10)37(35,36)33-12-6-4-11(5-7-12)32-14(34)15(21)16(22,23)18(26,27)20(30,31)19(28,29)17(15,24)25/h2-9,33H,1H3,(H,32,34) |
| InChIKey | HSURHBFOMYCDMV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|