C20H19BrN2O4 — CID 5218270
5-bromo-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 5218270) has the molecular formula C20H19BrN2O4 and a molecular weight of 431.29 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 5218270 |
| Molecular Formula | C20H19BrN2O4 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 5-bromo-N'-[2-(2,5-dimethylphenoxy)acetyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)c2oc3ccc(Br)cc3c2C)c1 |
| InChI | InChI=1S/C20H19BrN2O4/c1-11-4-5-12(2)17(8-11)26-10-18(24)22-23-20(25)19-13(3)15-9-14(21)6-7-16(15)27-19/h4-9H,10H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | JLKWZCBFMJBLKR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|