C11H16NO4+ — CID 5219059
2-methyl-5-(morpholin-4-ium-4-ylmethyl)furan-3-carboxylic acid (PubChem CID 5219059) has the molecular formula C11H16NO4+ and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-methyl-5-(morpholin-4-ium-4-ylmethyl)furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-(morpholin-4-ium-4-ylmethyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 5219059 |
| Molecular Formula | C11H16NO4+ |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-methyl-5-(morpholin-4-ium-4-ylmethyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(C[NH+]2CCOCC2)cc1C(=O)O |
| InChI | InChI=1S/C11H15NO4/c1-8-10(11(13)14)6-9(16-8)7-12-2-4-15-5-3-12/h6H,2-5,7H2,1H3,(H,13,14)/p+1 |
| InChIKey | PKBZNPNFTAYUHE-UHFFFAOYSA-O |
| XLogP | -0.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |