C31H40N2O6 — CID 5219325
[1-[2-(diethylazaniumyl)ethyl]-2-(3-ethoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate (PubChem CID 5219325) has the molecular formula C31H40N2O6 and a molecular weight of 536.67 g/mol. Its IUPAC name is [1-[2-(diethylazaniumyl)ethyl]-2-(3-ethoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate.
| Compound Name | [1-[2-(diethylazaniumyl)ethyl]-2-(3-ethoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
|---|---|
| PubChem CID | 5219325 |
| Molecular Formula | C31H40N2O6 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | [1-[2-(diethylazaniumyl)ethyl]-2-(3-ethoxy-4-propoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
| SMILES | CCCOc1ccc(C2C(=C([O-])c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2CC[NH+](CC)CC)cc1OCC |
| InChI | InChI=1S/C31H40N2O6/c1-6-16-38-25-13-10-21(19-26(25)37-9-4)28-27(30(35)31(36)33(28)15-14-32(7-2)8-3)29(34)22-11-12-24-23(18-22)17-20(5)39-24/h10-13,18-20,28,34H,6-9,14-17H2,1-5H3 |
| InChIKey | XIJXJIQBNYPZFR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|