C25H23N3O4S2 — CID 5220025
[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 5220025) has the molecular formula C25H23N3O4S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 5220025 |
| Molecular Formula | C25H23N3O4S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | Cc1c(NC(=O)C(C)OC(=O)C(=Cc2cccs2)c2cccs2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H23N3O4S2/c1-16-22(24(30)28(27(16)3)18-9-5-4-6-10-18)26-23(29)17(2)32-25(31)20(21-12-8-14-34-21)15-19-11-7-13-33-19/h4-15,17H,1-3H3,(H,26,29) |
| InChIKey | KFXBFYLQMRHTSV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|