C17H17NO3S2 — CID 8819586
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8819586) has the molecular formula C17H17NO3S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8819586 |
| Molecular Formula | C17H17NO3S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C(=C/c1cccs1)c1cccs1)C(=O)NC1CC1 |
| InChI | InChI=1S/C17H17NO3S2/c1-11(16(19)18-12-6-7-12)21-17(20)14(15-5-3-9-23-15)10-13-4-2-8-22-13/h2-5,8-12H,6-7H2,1H3,(H,18,19)/b14-10+/t11-/m1/s1 |
| InChIKey | MGKCDFBBAGEXJQ-ZTMOJVSCSA-N |
| XLogP | 3.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|