C27H21NO5S2 — CID 3961553
[1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 3961553) has the molecular formula C27H21NO5S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 3961553 |
| Molecular Formula | C27H21NO5S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | [1-[(2-methoxydibenzofuran-3-yl)amino]-1-oxopropan-2-yl] 2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | COc1cc2c(cc1NC(=O)C(C)OC(=O)C(=Cc1cccs1)c1cccs1)oc1ccccc12 |
| InChI | InChI=1S/C27H21NO5S2/c1-16(32-27(30)20(25-10-6-12-35-25)13-17-7-5-11-34-17)26(29)28-21-15-23-19(14-24(21)31-2)18-8-3-4-9-22(18)33-23/h3-16H,1-2H3,(H,28,29) |
| InChIKey | NBHKJCJCCHEAGS-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|