C15H12O4S2 — CID 2360279
[(3R)-2-oxooxolan-3-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 2360279) has the molecular formula C15H12O4S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2360279 |
| Molecular Formula | C15H12O4S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(O[C@@H]1CCOC1=O)/C(=C/c1cccs1)c1cccs1 |
| InChI | InChI=1S/C15H12O4S2/c16-14(19-12-5-6-18-15(12)17)11(13-4-2-8-21-13)9-10-3-1-7-20-10/h1-4,7-9,12H,5-6H2/b11-9+/t12-/m1/s1 |
| InChIKey | KJDQFLACRDOZLI-LMMOQWNQSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|