(2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate

C15H12O4S2 — CID 3626958

IUPAC(2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate
SMILESO=C(OC1CCOC1=O)C(=Cc1cccs1)c1cccs1
InChIInChI=1S/C15H12O4S2/c16-14(19-12-5-6-18-15(12)17)11(13-4-2-8-21-13)9-10-3-1-7-20-10/h1-4,7-9,12H,5-6H2
InChIKeyKJDQFLACRDOZLI-UHFFFAOYSA-N
MW320.39 g/mol
LogP3.21
Rot. Bonds4

About (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate

(2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 3626958) has the molecular formula C15H12O4S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate.

Molecular Properties

Compound Name(2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate
PubChem CID3626958
Molecular FormulaC15H12O4S2
Molecular Weight320.39 g/mol
Exact Mass320.02
IUPAC Name(2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate
SMILESO=C(OC1CCOC1=O)C(=Cc1cccs1)c1cccs1
InChIInChI=1S/C15H12O4S2/c16-14(19-12-5-6-18-15(12)17)11(13-4-2-8-21-13)9-10-3-1-7-20-10/h1-4,7-9,12H,5-6H2
InChIKeyKJDQFLACRDOZLI-UHFFFAOYSA-N
XLogP3.21
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.39
LogP ≤ 53.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate?
The IUPAC name of (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate (CID 3626958) is (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate.
What is the SMILES notation for (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate?
The canonical SMILES for (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate is O=C(OC1CCOC1=O)C(=Cc1cccs1)c1cccs1.
What is the InChIKey of (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate?
The InChIKey is KJDQFLACRDOZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O4S2/c16-14(19-12-5-6-18-15(12)17)11(13-4-2-8-21-13)9-10-3-1-7-20-10/h1-4,7-9,12H,5-6H2.
What are the key properties of (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate?
(2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate has a molecular weight of 320.39 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 2,3-dithiophen-2-ylprop-2-enoate is sourced from PubChem (CID 3626958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).