C21H16N2O3S2 — CID 8938647
[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8938647) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8938647 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C(=C/c1cccs1)c1cccs1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H16N2O3S2/c1-14(19-22-23-20(26-19)15-7-3-2-4-8-15)25-21(24)17(18-10-6-12-28-18)13-16-9-5-11-27-16/h2-14H,1H3/b17-13+/t14-/m1/s1 |
| InChIKey | OHEOBJIXKXMEQD-INQVIGDZSA-N |
| XLogP | 5.70 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|