C29H33N5O4S2 — CID 5220828
3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-2-(3-morpholin-4-ylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5220828) has the molecular formula C29H33N5O4S2 and a molecular weight of 579.75 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-2-(3-morpholin-4-ylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-2-(3-morpholin-4-ylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5220828 |
| Molecular Formula | C29H33N5O4S2 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-2-(3-morpholin-4-ylpropylamino)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CCN2C(=O)C(=Cc3c(NCCCN4CCOCC4)nc4c(C)cccn4c3=O)SC2=S)cc1 |
| InChI | InChI=1S/C29H33N5O4S2/c1-20-5-3-13-33-26(20)31-25(30-11-4-12-32-15-17-38-18-16-32)23(27(33)35)19-24-28(36)34(29(39)40-24)14-10-21-6-8-22(37-2)9-7-21/h3,5-9,13,19,30H,4,10-12,14-18H2,1-2H3 |
| InChIKey | NPWXSSDJNFZKDV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|