C25H26N4O3S2 — CID 3773437
3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3773437) has the molecular formula C25H26N4O3S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3773437 |
| Molecular Formula | C25H26N4O3S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethyl]-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCNc1nc2c(C)cccn2c(=O)c1C=C1SC(=S)N(CCc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C25H26N4O3S2/c1-4-12-26-21-19(23(30)28-13-5-6-16(2)22(28)27-21)15-20-24(31)29(25(33)34-20)14-11-17-7-9-18(32-3)10-8-17/h5-10,13,15,26H,4,11-12,14H2,1-3H3 |
| InChIKey | BSTGFBNJXBJKRK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|